C7H9F3O4S — CID 65442917
2-[1-(trifluoromethylsulfonylmethyl)cyclopropyl]acetic acid (PubChem CID 65442917) has the molecular formula C7H9F3O4S and a molecular weight of 246.21 g/mol. Its IUPAC name is 2-[1-(trifluoromethylsulfonylmethyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(trifluoromethylsulfonylmethyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65442917 |
| Molecular Formula | C7H9F3O4S |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 2-[1-(trifluoromethylsulfonylmethyl)cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C7H9F3O4S/c8-7(9,10)15(13,14)4-6(1-2-6)3-5(11)12/h1-4H2,(H,11,12) |
| InChIKey | WWDSVAWIUURFAN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |