(2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid

C7H11F3O4S — CID 21341067

IUPAC(2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid
SMILESCC[C@H](C)[C@@H](C(=O)O)S(=O)(=O)C(F)(F)F
InChIInChI=1S/C7H11F3O4S/c1-3-4(2)5(6(11)12)15(13,14)7(8,9)10/h4-5H,3H2,1-2H3,(H,11,12)/t4-,5-/m0/s1
InChIKeyUDSUEQQFMNOHEP-WHFBIAKZSA-N
MW248.22 g/mol
LogP1.42
Rot. Bonds4

About (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid

(2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid (PubChem CID 21341067) has the molecular formula C7H11F3O4S and a molecular weight of 248.22 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid.

Molecular Properties

Compound Name(2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid
PubChem CID21341067
Molecular FormulaC7H11F3O4S
Molecular Weight248.22 g/mol
Exact Mass248.03
IUPAC Name(2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid
SMILESCC[C@H](C)[C@@H](C(=O)O)S(=O)(=O)C(F)(F)F
InChIInChI=1S/C7H11F3O4S/c1-3-4(2)5(6(11)12)15(13,14)7(8,9)10/h4-5H,3H2,1-2H3,(H,11,12)/t4-,5-/m0/s1
InChIKeyUDSUEQQFMNOHEP-WHFBIAKZSA-N
XLogP1.42
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.22
LogP ≤ 51.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid?
The IUPAC name of (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid (CID 21341067) is (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid.
What is the SMILES notation for (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid?
The canonical SMILES for (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid is CC[C@H](C)[C@@H](C(=O)O)S(=O)(=O)C(F)(F)F.
What is the InChIKey of (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid?
The InChIKey is UDSUEQQFMNOHEP-WHFBIAKZSA-N. The full InChI is InChI=1S/C7H11F3O4S/c1-3-4(2)5(6(11)12)15(13,14)7(8,9)10/h4-5H,3H2,1-2H3,(H,11,12)/t4-,5-/m0/s1.
What are the key properties of (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid?
(2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid has a molecular weight of 248.22 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-methyl-2-(trifluoromethylsulfonyl)pentanoic acid is sourced from PubChem (CID 21341067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).