C15H19FO4S — CID 107776609
methyl 2-[1-[(4-fluoro-2-methylphenyl)methylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776609) has the molecular formula C15H19FO4S and a molecular weight of 314.38 g/mol. Its IUPAC name is methyl 2-[1-[(4-fluoro-2-methylphenyl)methylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(4-fluoro-2-methylphenyl)methylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776609 |
| Molecular Formula | C15H19FO4S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | methyl 2-[1-[(4-fluoro-2-methylphenyl)methylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)Cc2ccc(F)cc2C)CC1 |
| InChI | InChI=1S/C15H19FO4S/c1-11-7-13(16)4-3-12(11)9-21(18,19)10-15(5-6-15)8-14(17)20-2/h3-4,7H,5-6,8-10H2,1-2H3 |
| InChIKey | KMPRUVVDLAQOSG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |