C13H25NO4S — CID 107778187
methyl 2-[1-[4-(methylamino)pentylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 107778187) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is methyl 2-[1-[4-(methylamino)pentylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[4-(methylamino)pentylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107778187 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl 2-[1-[4-(methylamino)pentylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | CNC(C)CCCS(=O)(=O)CC1(CC(=O)OC)CC1 |
| InChI | InChI=1S/C13H25NO4S/c1-11(14-2)5-4-8-19(16,17)10-13(6-7-13)9-12(15)18-3/h11,14H,4-10H2,1-3H3 |
| InChIKey | NDEQFBIWFHAIHJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |