C10H19NO4S — CID 107778276
methyl 2-[1-[2-(methylamino)ethylsulfonylmethyl]cyclopropyl]acetate (PubChem CID 107778276) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is methyl 2-[1-[2-(methylamino)ethylsulfonylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[2-(methylamino)ethylsulfonylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107778276 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 2-[1-[2-(methylamino)ethylsulfonylmethyl]cyclopropyl]acetate |
| SMILES | CNCCS(=O)(=O)CC1(CC(=O)OC)CC1 |
| InChI | InChI=1S/C10H19NO4S/c1-11-5-6-16(13,14)8-10(3-4-10)7-9(12)15-2/h11H,3-8H2,1-2H3 |
| InChIKey | JDRZWSLDNLCUSZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |