C7H8N2O2S — CID 107778961
2-(1H-imidazol-2-ylsulfanylmethyl)prop-2-enoic acid (PubChem CID 107778961) has the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-(1H-imidazol-2-ylsulfanylmethyl)prop-2-enoic acid.
| Compound Name | 2-(1H-imidazol-2-ylsulfanylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 107778961 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 2-(1H-imidazol-2-ylsulfanylmethyl)prop-2-enoic acid |
| SMILES | C=C(CSc1ncc[nH]1)C(=O)O |
| InChI | InChI=1S/C7H8N2O2S/c1-5(6(10)11)4-12-7-8-2-3-9-7/h2-3H,1,4H2,(H,8,9)(H,10,11) |
| InChIKey | JDLSXZIRAGOZAZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|