C7H11N3O2S — CID 107781808
methyl 2-amino-3-(1H-imidazol-2-ylsulfanyl)propanoate (PubChem CID 107781808) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is methyl 2-amino-3-(1H-imidazol-2-ylsulfanyl)propanoate.
| Compound Name | methyl 2-amino-3-(1H-imidazol-2-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 107781808 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | methyl 2-amino-3-(1H-imidazol-2-ylsulfanyl)propanoate |
| SMILES | COC(=O)C(N)CSc1ncc[nH]1 |
| InChI | InChI=1S/C7H11N3O2S/c1-12-6(11)5(8)4-13-7-9-2-3-10-7/h2-3,5H,4,8H2,1H3,(H,9,10) |
| InChIKey | XTHGAYHXPXOTDO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |