C9H15N3O2S — CID 107781988
3-(1H-imidazol-2-ylsulfanyl)-2-(propylamino)propanoic acid (PubChem CID 107781988) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-(1H-imidazol-2-ylsulfanyl)-2-(propylamino)propanoic acid.
| Compound Name | 3-(1H-imidazol-2-ylsulfanyl)-2-(propylamino)propanoic acid |
|---|---|
| PubChem CID | 107781988 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-(1H-imidazol-2-ylsulfanyl)-2-(propylamino)propanoic acid |
| SMILES | CCCNC(CSc1ncc[nH]1)C(=O)O |
| InChI | InChI=1S/C9H15N3O2S/c1-2-3-10-7(8(13)14)6-15-9-11-4-5-12-9/h4-5,7,10H,2-3,6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | RAWPEEKMFVYDIZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |