C11H23NO2S — CID 107756351
3-(3-methylbutylsulfanyl)-2-(propylamino)propanoic acid (PubChem CID 107756351) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 3-(3-methylbutylsulfanyl)-2-(propylamino)propanoic acid.
| Compound Name | 3-(3-methylbutylsulfanyl)-2-(propylamino)propanoic acid |
|---|---|
| PubChem CID | 107756351 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-(3-methylbutylsulfanyl)-2-(propylamino)propanoic acid |
| SMILES | CCCNC(CSCCC(C)C)C(=O)O |
| InChI | InChI=1S/C11H23NO2S/c1-4-6-12-10(11(13)14)8-15-7-5-9(2)3/h9-10,12H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | NXLLHLCHCQZNRC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|