C16H32N2O4S2 — CID 87470743
(2R)-3-[[2-carboxy-2-(pentylamino)ethyl]disulfanyl]-2-(pentylamino)propanoic acid (PubChem CID 87470743) has the molecular formula C16H32N2O4S2 and a molecular weight of 380.58 g/mol. Its IUPAC name is (2R)-3-[[2-carboxy-2-(pentylamino)ethyl]disulfanyl]-2-(pentylamino)propanoic acid.
| Compound Name | (2R)-3-[[2-carboxy-2-(pentylamino)ethyl]disulfanyl]-2-(pentylamino)propanoic acid |
|---|---|
| PubChem CID | 87470743 |
| Molecular Formula | C16H32N2O4S2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (2R)-3-[[2-carboxy-2-(pentylamino)ethyl]disulfanyl]-2-(pentylamino)propanoic acid |
| SMILES | CCCCCNC(CSSC[C@H](NCCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H32N2O4S2/c1-3-5-7-9-17-13(15(19)20)11-23-24-12-14(16(21)22)18-10-8-6-4-2/h13-14,17-18H,3-12H2,1-2H3,(H,19,20)(H,21,22)/t13-,14?/m0/s1 |
| InChIKey | KGEUGUMMZALBMP-LSLKUGRBSA-N |
| XLogP | 2.83 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|