C9H7N3O2S — CID 107779217
3-(1H-imidazol-2-ylsulfanyl)pyridine-4-carboxylic acid (PubChem CID 107779217) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is 3-(1H-imidazol-2-ylsulfanyl)pyridine-4-carboxylic acid.
| Compound Name | 3-(1H-imidazol-2-ylsulfanyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107779217 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 3-(1H-imidazol-2-ylsulfanyl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccncc1Sc1ncc[nH]1 |
| InChI | InChI=1S/C9H7N3O2S/c13-8(14)6-1-2-10-5-7(6)15-9-11-3-4-12-9/h1-5H,(H,11,12)(H,13,14) |
| InChIKey | LKFMRIVZCMERIO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |