C13H11F3N2O2S — CID 107780259
N'-hydroxy-5-(2-methylfuran-3-yl)sulfanyl-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 107780259) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is N'-hydroxy-5-(2-methylfuran-3-yl)sulfanyl-2-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-5-(2-methylfuran-3-yl)sulfanyl-2-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107780259 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N'-hydroxy-5-(2-methylfuran-3-yl)sulfanyl-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | Cc1occc1Sc1ccc(C(F)(F)F)c(/C(N)=N/O)c1 |
| InChI | InChI=1S/C13H11F3N2O2S/c1-7-11(4-5-20-7)21-8-2-3-10(13(14,15)16)9(6-8)12(17)18-19/h2-6,19H,1H3,(H2,17,18) |
| InChIKey | BGNIKEQILILNFG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|