C13H13FN2O2S — CID 107780326
5-fluoro-N'-hydroxy-2-[(2-methylfuran-3-yl)sulfanylmethyl]benzenecarboximidamide (PubChem CID 107780326) has the molecular formula C13H13FN2O2S and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-fluoro-N'-hydroxy-2-[(2-methylfuran-3-yl)sulfanylmethyl]benzenecarboximidamide.
| Compound Name | 5-fluoro-N'-hydroxy-2-[(2-methylfuran-3-yl)sulfanylmethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107780326 |
| Molecular Formula | C13H13FN2O2S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-fluoro-N'-hydroxy-2-[(2-methylfuran-3-yl)sulfanylmethyl]benzenecarboximidamide |
| SMILES | Cc1occc1SCc1ccc(F)cc1/C(N)=N/O |
| InChI | InChI=1S/C13H13FN2O2S/c1-8-12(4-5-18-8)19-7-9-2-3-10(14)6-11(9)13(15)16-17/h2-6,17H,7H2,1H3,(H2,15,16) |
| InChIKey | JLVAHLJGZXGCEO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|