C10H9N3OS — CID 107780515
1-[6-(1H-imidazol-2-ylsulfanyl)-3-pyridinyl]ethanone (PubChem CID 107780515) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is 1-[6-(1H-imidazol-2-ylsulfanyl)-3-pyridinyl]ethanone.
| Compound Name | 1-[6-(1H-imidazol-2-ylsulfanyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 107780515 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1-[6-(1H-imidazol-2-ylsulfanyl)-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(Sc2ncc[nH]2)nc1 |
| InChI | InChI=1S/C10H9N3OS/c1-7(14)8-2-3-9(13-6-8)15-10-11-4-5-12-10/h2-6H,1H3,(H,11,12) |
| InChIKey | VHZHWPZTVZQDHQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |