C11H12BrN3S — CID 107780579
(1S)-1-[3-bromo-4-(1H-imidazol-2-ylsulfanyl)phenyl]ethanamine (PubChem CID 107780579) has the molecular formula C11H12BrN3S and a molecular weight of 298.21 g/mol. Its IUPAC name is (1S)-1-[3-bromo-4-(1H-imidazol-2-ylsulfanyl)phenyl]ethanamine.
| Compound Name | (1S)-1-[3-bromo-4-(1H-imidazol-2-ylsulfanyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 107780579 |
| Molecular Formula | C11H12BrN3S |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | (1S)-1-[3-bromo-4-(1H-imidazol-2-ylsulfanyl)phenyl]ethanamine |
| SMILES | C[C@H](N)c1ccc(Sc2ncc[nH]2)c(Br)c1 |
| InChI | InChI=1S/C11H12BrN3S/c1-7(13)8-2-3-10(9(12)6-8)16-11-14-4-5-15-11/h2-7H,13H2,1H3,(H,14,15)/t7-/m0/s1 |
| InChIKey | ZRDODNKFTICZPW-ZETCQYMHSA-N |
| XLogP | 3.34 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |