C12H14FN3S — CID 114000787
1-[5-fluoro-2-(1H-imidazol-2-ylsulfanyl)-4-methylphenyl]ethanamine (PubChem CID 114000787) has the molecular formula C12H14FN3S and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[5-fluoro-2-(1H-imidazol-2-ylsulfanyl)-4-methylphenyl]ethanamine.
| Compound Name | 1-[5-fluoro-2-(1H-imidazol-2-ylsulfanyl)-4-methylphenyl]ethanamine |
|---|---|
| PubChem CID | 114000787 |
| Molecular Formula | C12H14FN3S |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1-[5-fluoro-2-(1H-imidazol-2-ylsulfanyl)-4-methylphenyl]ethanamine |
| SMILES | Cc1cc(Sc2ncc[nH]2)c(C(C)N)cc1F |
| InChI | InChI=1S/C12H14FN3S/c1-7-5-11(17-12-15-3-4-16-12)9(8(2)14)6-10(7)13/h3-6,8H,14H2,1-2H3,(H,15,16) |
| InChIKey | VLMYQTJKHQLIAM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |