C16H19NO3S — CID 107782026
2-(methylamino)-4-(2-methylfuran-3-yl)sulfanyl-2-phenylbutanoic acid (PubChem CID 107782026) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(methylamino)-4-(2-methylfuran-3-yl)sulfanyl-2-phenylbutanoic acid.
| Compound Name | 2-(methylamino)-4-(2-methylfuran-3-yl)sulfanyl-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 107782026 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-(methylamino)-4-(2-methylfuran-3-yl)sulfanyl-2-phenylbutanoic acid |
| SMILES | CNC(CCSc1ccoc1C)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO3S/c1-12-14(8-10-20-12)21-11-9-16(17-2,15(18)19)13-6-4-3-5-7-13/h3-8,10,17H,9,11H2,1-2H3,(H,18,19) |
| InChIKey | WTYRZOBLOLHZTL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |