C16H19N3OS — CID 116694816
2-(methylamino)-2-phenyl-4-pyridin-4-ylsulfanylbutanamide (PubChem CID 116694816) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-(methylamino)-2-phenyl-4-pyridin-4-ylsulfanylbutanamide.
| Compound Name | 2-(methylamino)-2-phenyl-4-pyridin-4-ylsulfanylbutanamide |
|---|---|
| PubChem CID | 116694816 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-(methylamino)-2-phenyl-4-pyridin-4-ylsulfanylbutanamide |
| SMILES | CNC(CCSc1ccncc1)(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C16H19N3OS/c1-18-16(15(17)20,13-5-3-2-4-6-13)9-12-21-14-7-10-19-11-8-14/h2-8,10-11,18H,9,12H2,1H3,(H2,17,20) |
| InChIKey | OAEAJVPWYUAFJT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |