C10H19N3OS — CID 107783953
3-amino-2-(1H-imidazol-2-ylsulfanyl)-4,4-dimethylpentan-1-ol (PubChem CID 107783953) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 3-amino-2-(1H-imidazol-2-ylsulfanyl)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-amino-2-(1H-imidazol-2-ylsulfanyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 107783953 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-amino-2-(1H-imidazol-2-ylsulfanyl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)C(N)C(CO)Sc1ncc[nH]1 |
| InChI | InChI=1S/C10H19N3OS/c1-10(2,3)8(11)7(6-14)15-9-12-4-5-13-9/h4-5,7-8,14H,6,11H2,1-3H3,(H,12,13) |
| InChIKey | SERGHJHKNUGWBG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |