C11H10F3N3OS — CID 107785223
N-methyl-6-(2-methylfuran-3-yl)sulfanyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 107785223) has the molecular formula C11H10F3N3OS and a molecular weight of 289.28 g/mol. Its IUPAC name is N-methyl-6-(2-methylfuran-3-yl)sulfanyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-methyl-6-(2-methylfuran-3-yl)sulfanyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107785223 |
| Molecular Formula | C11H10F3N3OS |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-methyl-6-(2-methylfuran-3-yl)sulfanyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CNc1cc(Sc2ccoc2C)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H10F3N3OS/c1-6-7(3-4-18-6)19-9-5-8(15-2)16-10(17-9)11(12,13)14/h3-5H,1-2H3,(H,15,16,17) |
| InChIKey | ZZEWEYDNOSFAOR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |