C10H7Br2N3O3S2 — CID 107786304
3-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786304) has the molecular formula C10H7Br2N3O3S2 and a molecular weight of 441.13 g/mol. Its IUPAC name is 3-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786304 |
| Molecular Formula | C10H7Br2N3O3S2 |
| Molecular Weight | 441.13 g/mol |
| Exact Mass | 438.83 |
| IUPAC Name | 3-[2-(2,5-dibromothiophen-3-yl)-2-oxoethyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H7Br2N3O3S2/c1-15-10(13-8(17)9(18)14-15)19-3-5(16)4-2-6(11)20-7(4)12/h2H,3H2,1H3,(H,14,18) |
| InChIKey | DXKAYPIHUFTGEG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|