C15H15BrCl2N2O — CID 107787009
4-N-(4-bromo-2,3-dichlorophenyl)-2-propan-2-yloxybenzene-1,4-diamine (PubChem CID 107787009) has the molecular formula C15H15BrCl2N2O and a molecular weight of 390.11 g/mol. Its IUPAC name is 4-N-(4-bromo-2,3-dichlorophenyl)-2-propan-2-yloxybenzene-1,4-diamine.
| Compound Name | 4-N-(4-bromo-2,3-dichlorophenyl)-2-propan-2-yloxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 107787009 |
| Molecular Formula | C15H15BrCl2N2O |
| Molecular Weight | 390.11 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 4-N-(4-bromo-2,3-dichlorophenyl)-2-propan-2-yloxybenzene-1,4-diamine |
| SMILES | CC(C)Oc1cc(Nc2ccc(Br)c(Cl)c2Cl)ccc1N |
| InChI | InChI=1S/C15H15BrCl2N2O/c1-8(2)21-13-7-9(3-5-11(13)19)20-12-6-4-10(16)14(17)15(12)18/h3-8,20H,19H2,1-2H3 |
| InChIKey | ZITAISPTWWDFBO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.11 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|