C11H19N3O — CID 83012844
4-(2,2-dimethylhydrazinyl)-2-propan-2-yloxyaniline (PubChem CID 83012844) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-2-propan-2-yloxyaniline.
| Compound Name | 4-(2,2-dimethylhydrazinyl)-2-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 83012844 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)-2-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(NN(C)C)ccc1N |
| InChI | InChI=1S/C11H19N3O/c1-8(2)15-11-7-9(13-14(3)4)5-6-10(11)12/h5-8,13H,12H2,1-4H3 |
| InChIKey | PHZSFUFXLSXQAN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|