C13H19F3N2O — CID 83002196
2-propan-2-yloxy-4-N-(4,4,4-trifluorobutyl)benzene-1,4-diamine (PubChem CID 83002196) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-propan-2-yloxy-4-N-(4,4,4-trifluorobutyl)benzene-1,4-diamine.
| Compound Name | 2-propan-2-yloxy-4-N-(4,4,4-trifluorobutyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 83002196 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-propan-2-yloxy-4-N-(4,4,4-trifluorobutyl)benzene-1,4-diamine |
| SMILES | CC(C)Oc1cc(NCCCC(F)(F)F)ccc1N |
| InChI | InChI=1S/C13H19F3N2O/c1-9(2)19-12-8-10(4-5-11(12)17)18-7-3-6-13(14,15)16/h4-5,8-9,18H,3,6-7,17H2,1-2H3 |
| InChIKey | LAWRNKUGBQTMGU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|