C16H14BrCl2NO — CID 107787470
4-bromo-2,3-dichloro-N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]aniline (PubChem CID 107787470) has the molecular formula C16H14BrCl2NO and a molecular weight of 387.10 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 107787470 |
| Molecular Formula | C16H14BrCl2NO |
| Molecular Weight | 387.10 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]aniline |
| SMILES | CC(Nc1ccc(Br)c(Cl)c1Cl)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H14BrCl2NO/c1-9(10-2-5-14-11(8-10)6-7-21-14)20-13-4-3-12(17)15(18)16(13)19/h2-5,8-9,20H,6-7H2,1H3 |
| InChIKey | ANCWJQDKQLEQHU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.10 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|