C15H14BrCl2N — CID 107788093
4-bromo-2,3-dichloro-N-[1-(3-methylphenyl)ethyl]aniline (PubChem CID 107788093) has the molecular formula C15H14BrCl2N and a molecular weight of 359.09 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[1-(3-methylphenyl)ethyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[1-(3-methylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 107788093 |
| Molecular Formula | C15H14BrCl2N |
| Molecular Weight | 359.09 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[1-(3-methylphenyl)ethyl]aniline |
| SMILES | Cc1cccc(C(C)Nc2ccc(Br)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H14BrCl2N/c1-9-4-3-5-11(8-9)10(2)19-13-7-6-12(16)14(17)15(13)18/h3-8,10,19H,1-2H3 |
| InChIKey | AIKUTAPTKFXQCQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.09 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|