C16H22BrCl2NO — CID 107787809
4-bromo-2,3-dichloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]aniline (PubChem CID 107787809) has the molecular formula C16H22BrCl2NO and a molecular weight of 395.17 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]aniline |
|---|---|
| PubChem CID | 107787809 |
| Molecular Formula | C16H22BrCl2NO |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]aniline |
| SMILES | CC(C)COC1CC(Nc2ccc(Br)c(Cl)c2Cl)C1(C)C |
| InChI | InChI=1S/C16H22BrCl2NO/c1-9(2)8-21-13-7-12(16(13,3)4)20-11-6-5-10(17)14(18)15(11)19/h5-6,9,12-13,20H,7-8H2,1-4H3 |
| InChIKey | PEYVQRMXHPKKAZ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|