C15H17N3 — CID 107788366
4-(1-cyclobutylpropan-2-ylamino)benzene-1,2-dicarbonitrile (PubChem CID 107788366) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-(1-cyclobutylpropan-2-ylamino)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(1-cyclobutylpropan-2-ylamino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107788366 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-(1-cyclobutylpropan-2-ylamino)benzene-1,2-dicarbonitrile |
| SMILES | CC(CC1CCC1)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C15H17N3/c1-11(7-12-3-2-4-12)18-15-6-5-13(9-16)14(8-15)10-17/h5-6,8,11-12,18H,2-4,7H2,1H3 |
| InChIKey | IEMVTARLOWQLEF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |