C13H8BrCl3N2O2 — CID 107789015
4-bromo-2,3-dichloro-N-[(4-chloro-3-nitrophenyl)methyl]aniline (PubChem CID 107789015) has the molecular formula C13H8BrCl3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[(4-chloro-3-nitrophenyl)methyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[(4-chloro-3-nitrophenyl)methyl]aniline |
|---|---|
| PubChem CID | 107789015 |
| Molecular Formula | C13H8BrCl3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 407.88 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[(4-chloro-3-nitrophenyl)methyl]aniline |
| SMILES | O=[N+]([O-])c1cc(CNc2ccc(Br)c(Cl)c2Cl)ccc1Cl |
| InChI | InChI=1S/C13H8BrCl3N2O2/c14-8-2-4-10(13(17)12(8)16)18-6-7-1-3-9(15)11(5-7)19(20)21/h1-5,18H,6H2 |
| InChIKey | FTIKIQYRGWWELZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|