C13H9BrCl2N2O2 — CID 43758693
N-[(4-bromo-3-nitrophenyl)methyl]-2,4-dichloroaniline (PubChem CID 43758693) has the molecular formula C13H9BrCl2N2O2 and a molecular weight of 376.04 g/mol. Its IUPAC name is N-[(4-bromo-3-nitrophenyl)methyl]-2,4-dichloroaniline.
| Compound Name | N-[(4-bromo-3-nitrophenyl)methyl]-2,4-dichloroaniline |
|---|---|
| PubChem CID | 43758693 |
| Molecular Formula | C13H9BrCl2N2O2 |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | N-[(4-bromo-3-nitrophenyl)methyl]-2,4-dichloroaniline |
| SMILES | O=[N+]([O-])c1cc(CNc2ccc(Cl)cc2Cl)ccc1Br |
| InChI | InChI=1S/C13H9BrCl2N2O2/c14-10-3-1-8(5-13(10)18(19)20)7-17-12-4-2-9(15)6-11(12)16/h1-6,17H,7H2 |
| InChIKey | BZHDUVVDRIFXNM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|