C12H12BrF3N2O2S — CID 107789933
N-(2-bromo-4-carbamothioylphenyl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 107789933) has the molecular formula C12H12BrF3N2O2S and a molecular weight of 385.21 g/mol. Its IUPAC name is N-(2-bromo-4-carbamothioylphenyl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(2-bromo-4-carbamothioylphenyl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 107789933 |
| Molecular Formula | C12H12BrF3N2O2S |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | N-(2-bromo-4-carbamothioylphenyl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | NC(=S)c1ccc(NC(=O)CCOCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H12BrF3N2O2S/c13-8-5-7(11(17)21)1-2-9(8)18-10(19)3-4-20-6-12(14,15)16/h1-2,5H,3-4,6H2,(H2,17,21)(H,18,19) |
| InChIKey | NNNIJIAGHNKRQE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|