C9H9Cl2NO5 — CID 10779233
[3-(2,6-dichlorophenoxy)-2-hydroxypropyl] nitrate (PubChem CID 10779233) has the molecular formula C9H9Cl2NO5 and a molecular weight of 282.08 g/mol. Its IUPAC name is [3-(2,6-dichlorophenoxy)-2-hydroxypropyl] nitrate.
| Compound Name | [3-(2,6-dichlorophenoxy)-2-hydroxypropyl] nitrate |
|---|---|
| PubChem CID | 10779233 |
| Molecular Formula | C9H9Cl2NO5 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | [3-(2,6-dichlorophenoxy)-2-hydroxypropyl] nitrate |
| SMILES | O=[N+]([O-])OCC(O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2NO5/c10-7-2-1-3-8(11)9(7)16-4-6(13)5-17-12(14)15/h1-3,6,13H,4-5H2 |
| InChIKey | APDJGHSKEKDTKB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|