C13H13Cl2N3O4 — CID 109411147
1-(2,6-dichlorophenoxy)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (PubChem CID 109411147) has the molecular formula C13H13Cl2N3O4 and a molecular weight of 346.17 g/mol. Its IUPAC name is 1-(2,6-dichlorophenoxy)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol.
| Compound Name | 1-(2,6-dichlorophenoxy)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 109411147 |
| Molecular Formula | C13H13Cl2N3O4 |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 1-(2,6-dichlorophenoxy)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O4/c1-8-16-5-12(18(20)21)17(8)6-9(19)7-22-13-10(14)3-2-4-11(13)15/h2-5,9,19H,6-7H2,1H3 |
| InChIKey | UPCCUXUYEGGUMW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|