C7H12CaClN3O3 — CID 175230485
calcium;1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol;hydride (PubChem CID 175230485) has the molecular formula C7H12CaClN3O3 and a molecular weight of 261.72 g/mol. Its IUPAC name is calcium;1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol;hydride.
| Compound Name | calcium;1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol;hydride |
|---|---|
| PubChem CID | 175230485 |
| Molecular Formula | C7H12CaClN3O3 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | calcium;1-chloro-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol;hydride |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(O)CCl.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C7H10ClN3O3.Ca.2H/c1-5-9-3-7(11(13)14)10(5)4-6(12)2-8;;;/h3,6,12H,2,4H2,1H3;;;/q;+2;2*-1 |
| InChIKey | NUGJBURVTBOBLY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|