C9H16N4O4 — CID 146014908
1-(2-hydroxyethylamino)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (PubChem CID 146014908) has the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-(2-hydroxyethylamino)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol.
| Compound Name | 1-(2-hydroxyethylamino)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 146014908 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-(2-hydroxyethylamino)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(O)CNCCO |
| InChI | InChI=1S/C9H16N4O4/c1-7-11-5-9(13(16)17)12(7)6-8(15)4-10-2-3-14/h5,8,10,14-15H,2-4,6H2,1H3 |
| InChIKey | RBUARCBVTFLMDD-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|