C8H13IN4O3 — CID 67790834
1-(iodomethylamino)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (PubChem CID 67790834) has the molecular formula C8H13IN4O3 and a molecular weight of 340.12 g/mol. Its IUPAC name is 1-(iodomethylamino)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol.
| Compound Name | 1-(iodomethylamino)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 67790834 |
| Molecular Formula | C8H13IN4O3 |
| Molecular Weight | 340.12 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 1-(iodomethylamino)-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(O)CNCI |
| InChI | InChI=1S/C8H13IN4O3/c1-6-11-3-8(13(15)16)12(6)4-7(14)2-10-5-9/h3,7,10,14H,2,4-5H2,1H3 |
| InChIKey | PVUJQVUERUJUTD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.12 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|