C11H5Br2Cl2NO2 — CID 107792709
4-bromo-1-(4-bromo-2,3-dichlorophenyl)pyrrole-2-carboxylic acid (PubChem CID 107792709) has the molecular formula C11H5Br2Cl2NO2 and a molecular weight of 413.88 g/mol. Its IUPAC name is 4-bromo-1-(4-bromo-2,3-dichlorophenyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-bromo-1-(4-bromo-2,3-dichlorophenyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 107792709 |
| Molecular Formula | C11H5Br2Cl2NO2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 410.81 |
| IUPAC Name | 4-bromo-1-(4-bromo-2,3-dichlorophenyl)pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Br)cn1-c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C11H5Br2Cl2NO2/c12-5-3-8(11(17)18)16(4-5)7-2-1-6(13)9(14)10(7)15/h1-4H,(H,17,18) |
| InChIKey | DRYRZOSDDAAWBG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|