C11H5BrF3NO2 — CID 114605133
4-bromo-1-(2,4,5-trifluorophenyl)pyrrole-2-carboxylic acid (PubChem CID 114605133) has the molecular formula C11H5BrF3NO2 and a molecular weight of 320.06 g/mol. Its IUPAC name is 4-bromo-1-(2,4,5-trifluorophenyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-bromo-1-(2,4,5-trifluorophenyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114605133 |
| Molecular Formula | C11H5BrF3NO2 |
| Molecular Weight | 320.06 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 4-bromo-1-(2,4,5-trifluorophenyl)pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Br)cn1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H5BrF3NO2/c12-5-1-10(11(17)18)16(4-5)9-3-7(14)6(13)2-8(9)15/h1-4H,(H,17,18) |
| InChIKey | MMHYZEFZBWUNJR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.06 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|