C13H11BrCl2N4O — CID 107793423
N-(4-bromo-2,3-dichlorophenyl)-6-(ethylamino)pyridazine-3-carboxamide (PubChem CID 107793423) has the molecular formula C13H11BrCl2N4O and a molecular weight of 390.07 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-6-(ethylamino)pyridazine-3-carboxamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-6-(ethylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 107793423 |
| Molecular Formula | C13H11BrCl2N4O |
| Molecular Weight | 390.07 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-6-(ethylamino)pyridazine-3-carboxamide |
| SMILES | CCNc1ccc(C(=O)Nc2ccc(Br)c(Cl)c2Cl)nn1 |
| InChI | InChI=1S/C13H11BrCl2N4O/c1-2-17-10-6-5-9(19-20-10)13(21)18-8-4-3-7(14)11(15)12(8)16/h3-6H,2H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | SFRYKTJGAYQZPL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.07 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|