C10H7BrCl2N4OS — CID 107793429
N-(4-bromo-2,3-dichlorophenyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 107793429) has the molecular formula C10H7BrCl2N4OS and a molecular weight of 382.07 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 107793429 |
| Molecular Formula | C10H7BrCl2N4OS |
| Molecular Weight | 382.07 g/mol |
| Exact Mass | 379.89 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CNc1nnc(C(=O)Nc2ccc(Br)c(Cl)c2Cl)s1 |
| InChI | InChI=1S/C10H7BrCl2N4OS/c1-14-10-17-16-9(19-10)8(18)15-5-3-2-4(11)6(12)7(5)13/h2-3H,1H3,(H,14,17)(H,15,18) |
| InChIKey | NPJGTFMXFRXXQJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.07 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|