C10H9IN4OS — CID 80615800
N-(3-iodophenyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80615800) has the molecular formula C10H9IN4OS and a molecular weight of 360.18 g/mol. Its IUPAC name is N-(3-iodophenyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(3-iodophenyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80615800 |
| Molecular Formula | C10H9IN4OS |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | N-(3-iodophenyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CNc1nnc(C(=O)Nc2cccc(I)c2)s1 |
| InChI | InChI=1S/C10H9IN4OS/c1-12-10-15-14-9(17-10)8(16)13-7-4-2-3-6(11)5-7/h2-5H,1H3,(H,12,15)(H,13,16) |
| InChIKey | NLKGREHHOWYNFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|