C15H14FN3O2 — CID 107793542
2-fluoro-4-(5,6,7,8-tetrahydroquinazolin-4-ylamino)benzoic acid (PubChem CID 107793542) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-fluoro-4-(5,6,7,8-tetrahydroquinazolin-4-ylamino)benzoic acid.
| Compound Name | 2-fluoro-4-(5,6,7,8-tetrahydroquinazolin-4-ylamino)benzoic acid |
|---|---|
| PubChem CID | 107793542 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-fluoro-4-(5,6,7,8-tetrahydroquinazolin-4-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncnc3c2CCCC3)cc1F |
| InChI | InChI=1S/C15H14FN3O2/c16-12-7-9(5-6-10(12)15(20)21)19-14-11-3-1-2-4-13(11)17-8-18-14/h5-8H,1-4H2,(H,20,21)(H,17,18,19) |
| InChIKey | CNSRGMMYGBGFCP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |