C15H15FN4 — CID 107793644
3-fluoro-4-(1-propylimidazo[4,5-c]pyridin-2-yl)aniline (PubChem CID 107793644) has the molecular formula C15H15FN4 and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-fluoro-4-(1-propylimidazo[4,5-c]pyridin-2-yl)aniline.
| Compound Name | 3-fluoro-4-(1-propylimidazo[4,5-c]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 107793644 |
| Molecular Formula | C15H15FN4 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3-fluoro-4-(1-propylimidazo[4,5-c]pyridin-2-yl)aniline |
| SMILES | CCCn1c(-c2ccc(N)cc2F)nc2cnccc21 |
| InChI | InChI=1S/C15H15FN4/c1-2-7-20-14-5-6-18-9-13(14)19-15(20)11-4-3-10(17)8-12(11)16/h3-6,8-9H,2,7,17H2,1H3 |
| InChIKey | ANLOIFMIRBSZNF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|