C14H15BrCl2N2O2 — CID 107794472
1-(4-bromo-2,3-dichlorophenyl)-3,6-diethylpiperazine-2,5-dione (PubChem CID 107794472) has the molecular formula C14H15BrCl2N2O2 and a molecular weight of 394.10 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)-3,6-diethylpiperazine-2,5-dione.
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)-3,6-diethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107794472 |
| Molecular Formula | C14H15BrCl2N2O2 |
| Molecular Weight | 394.10 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)-3,6-diethylpiperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(CC)N(c2ccc(Br)c(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C14H15BrCl2N2O2/c1-3-8-14(21)19(9(4-2)13(20)18-8)10-6-5-7(15)11(16)12(10)17/h5-6,8-9H,3-4H2,1-2H3,(H,18,20) |
| InChIKey | HMQVVSYFTZPSOY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.10 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|