C12H9BrCl2N4O2 — CID 107795411
4-bromo-2,3-dichloro-N-(3-hydrazinyl-2-nitrophenyl)aniline (PubChem CID 107795411) has the molecular formula C12H9BrCl2N4O2 and a molecular weight of 392.04 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(3-hydrazinyl-2-nitrophenyl)aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-(3-hydrazinyl-2-nitrophenyl)aniline |
|---|---|
| PubChem CID | 107795411 |
| Molecular Formula | C12H9BrCl2N4O2 |
| Molecular Weight | 392.04 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(3-hydrazinyl-2-nitrophenyl)aniline |
| SMILES | NNc1cccc(Nc2ccc(Br)c(Cl)c2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9BrCl2N4O2/c13-6-4-5-7(11(15)10(6)14)17-8-2-1-3-9(18-16)12(8)19(20)21/h1-5,17-18H,16H2 |
| InChIKey | CWHXCTOEOWIZPU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.04 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|