C14H13BrClN3O2 — CID 80772520
3-N-(4-bromo-2-chlorophenyl)-1-N-ethyl-2-nitrobenzene-1,3-diamine (PubChem CID 80772520) has the molecular formula C14H13BrClN3O2 and a molecular weight of 370.63 g/mol. Its IUPAC name is 3-N-(4-bromo-2-chlorophenyl)-1-N-ethyl-2-nitrobenzene-1,3-diamine.
| Compound Name | 3-N-(4-bromo-2-chlorophenyl)-1-N-ethyl-2-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 80772520 |
| Molecular Formula | C14H13BrClN3O2 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 3-N-(4-bromo-2-chlorophenyl)-1-N-ethyl-2-nitrobenzene-1,3-diamine |
| SMILES | CCNc1cccc(Nc2ccc(Br)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13BrClN3O2/c1-2-17-12-4-3-5-13(14(12)19(20)21)18-11-7-6-9(15)8-10(11)16/h3-8,17-18H,2H2,1H3 |
| InChIKey | VZCYBTLNILAONF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|