C14H13ClFN3O2 — CID 80773568
3-N-(5-chloro-2-fluorophenyl)-1-N-ethyl-2-nitrobenzene-1,3-diamine (PubChem CID 80773568) has the molecular formula C14H13ClFN3O2 and a molecular weight of 309.73 g/mol. Its IUPAC name is 3-N-(5-chloro-2-fluorophenyl)-1-N-ethyl-2-nitrobenzene-1,3-diamine.
| Compound Name | 3-N-(5-chloro-2-fluorophenyl)-1-N-ethyl-2-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 80773568 |
| Molecular Formula | C14H13ClFN3O2 |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-N-(5-chloro-2-fluorophenyl)-1-N-ethyl-2-nitrobenzene-1,3-diamine |
| SMILES | CCNc1cccc(Nc2cc(Cl)ccc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13ClFN3O2/c1-2-17-11-4-3-5-12(14(11)19(20)21)18-13-8-9(15)6-7-10(13)16/h3-8,17-18H,2H2,1H3 |
| InChIKey | UCMGTSRWLIAWED-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|