C10H9BrCl2N4O — CID 107795977
5-(1-aminoethyl)-N-(4-bromo-2,3-dichlorophenyl)-1,3,4-oxadiazol-2-amine (PubChem CID 107795977) has the molecular formula C10H9BrCl2N4O and a molecular weight of 352.02 g/mol. Its IUPAC name is 5-(1-aminoethyl)-N-(4-bromo-2,3-dichlorophenyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-aminoethyl)-N-(4-bromo-2,3-dichlorophenyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 107795977 |
| Molecular Formula | C10H9BrCl2N4O |
| Molecular Weight | 352.02 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 5-(1-aminoethyl)-N-(4-bromo-2,3-dichlorophenyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(N)c1nnc(Nc2ccc(Br)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C10H9BrCl2N4O/c1-4(14)9-16-17-10(18-9)15-6-3-2-5(11)7(12)8(6)13/h2-4H,14H2,1H3,(H,15,17) |
| InChIKey | XPABKXVGNMXROK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.02 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|