C13H15FN2O3 — CID 107796472
2-fluoro-4-[[methyl(2-methylprop-2-enyl)carbamoyl]amino]benzoic acid (PubChem CID 107796472) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-fluoro-4-[[methyl(2-methylprop-2-enyl)carbamoyl]amino]benzoic acid.
| Compound Name | 2-fluoro-4-[[methyl(2-methylprop-2-enyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 107796472 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-fluoro-4-[[methyl(2-methylprop-2-enyl)carbamoyl]amino]benzoic acid |
| SMILES | C=C(C)CN(C)C(=O)Nc1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C13H15FN2O3/c1-8(2)7-16(3)13(19)15-9-4-5-10(12(17)18)11(14)6-9/h4-6H,1,7H2,2-3H3,(H,15,19)(H,17,18) |
| InChIKey | AVLGIIAILJYHIM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|