C12H15FN2O3 — CID 71969096
methyl 4-[[ethyl(methyl)carbamoyl]amino]-2-fluorobenzoate (PubChem CID 71969096) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is methyl 4-[[ethyl(methyl)carbamoyl]amino]-2-fluorobenzoate.
| Compound Name | methyl 4-[[ethyl(methyl)carbamoyl]amino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 71969096 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | methyl 4-[[ethyl(methyl)carbamoyl]amino]-2-fluorobenzoate |
| SMILES | CCN(C)C(=O)Nc1ccc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C12H15FN2O3/c1-4-15(2)12(17)14-8-5-6-9(10(13)7-8)11(16)18-3/h5-7H,4H2,1-3H3,(H,14,17) |
| InChIKey | HQAAAYDAOCFPTD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |